C21H34O3 — CID 71508211
(4E,6S,7R,10E)-6-hydroxy-4-(methoxymethyl)-10,14-dimethyl-7-prop-1-en-2-ylcyclotetradeca-4,10-dien-1-one (PubChem CID 71508211) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (4E,6S,7R,10E)-6-hydroxy-4-(methoxymethyl)-10,14-dimethyl-7-prop-1-en-2-ylcyclotetradeca-4,10-dien-1-one.
| Compound Name | (4E,6S,7R,10E)-6-hydroxy-4-(methoxymethyl)-10,14-dimethyl-7-prop-1-en-2-ylcyclotetradeca-4,10-dien-1-one |
|---|---|
| PubChem CID | 71508211 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (4E,6S,7R,10E)-6-hydroxy-4-(methoxymethyl)-10,14-dimethyl-7-prop-1-en-2-ylcyclotetradeca-4,10-dien-1-one |
| SMILES | C=C(C)[C@H]1CC/C(C)=C/CCC(C)C(=O)CC/C(COC)=C\[C@@H]1O |
| InChI | InChI=1S/C21H34O3/c1-15(2)19-11-9-16(3)7-6-8-17(4)20(22)12-10-18(14-24-5)13-21(19)23/h7,13,17,19,21,23H,1,6,8-12,14H2,2-5H3/b16-7+,18-13+/t17?,19-,21+/m1/s1 |
| InChIKey | KWAQCPGXANDQMY-YOKQZFIYSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|