C22H36O4 — CID 71508212
[(1R,2R,6S,10R,13R)-2,6,10-trimethyl-4,9-dioxo-13-prop-1-en-2-ylcyclotetradecyl] acetate (PubChem CID 71508212) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1R,2R,6S,10R,13R)-2,6,10-trimethyl-4,9-dioxo-13-prop-1-en-2-ylcyclotetradecyl] acetate.
| Compound Name | [(1R,2R,6S,10R,13R)-2,6,10-trimethyl-4,9-dioxo-13-prop-1-en-2-ylcyclotetradecyl] acetate |
|---|---|
| PubChem CID | 71508212 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,2R,6S,10R,13R)-2,6,10-trimethyl-4,9-dioxo-13-prop-1-en-2-ylcyclotetradecyl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C(=O)CC[C@H](C)CC(=O)C[C@@H](C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C22H36O4/c1-14(2)19-9-8-16(4)21(25)10-7-15(3)11-20(24)12-17(5)22(13-19)26-18(6)23/h15-17,19,22H,1,7-13H2,2-6H3/t15-,16+,17+,19+,22+/m0/s1 |
| InChIKey | IASAFXIPQZKOAE-GADAEZOWSA-N |
| XLogP | 4.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|