About (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide
(E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 71508275) has the molecular formula C15H10Cl2N2O2
and a molecular weight of 321.16 g/mol. Its IUPAC name is (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide |
| PubChem CID | 71508275 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccco1)C(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-13-4-3-10(6-14(13)17)9-19-15(20)11(8-18)7-12-2-1-5-21-12/h1-7H,9H2,(H,19,20)/b11-7+ |
| InChIKey | YBMYYBYDDNPUAR-YRNVUSSQSA-N |
| XLogP | 3.81 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide?
The IUPAC name of (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide (CID 71508275) is (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide.
What is the SMILES notation for (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide?
The canonical SMILES for (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide is N#C/C(=C\c1ccco1)C(=O)NCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide?
The InChIKey is YBMYYBYDDNPUAR-YRNVUSSQSA-N. The full InChI is InChI=1S/C15H10Cl2N2O2/c16-13-4-3-10(6-14(13)17)9-19-15(20)11(8-18)7-12-2-1-5-21-12/h1-7H,9H2,(H,19,20)/b11-7+.
What are the key properties of (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide?
(E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide has a molecular weight of 321.16 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-N-[(3,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide is sourced from PubChem (CID 71508275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).