C15H16ClN7 — CID 71508320
4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]pyrimidine-2,4,6-triamine (PubChem CID 71508320) has the molecular formula C15H16ClN7 and a molecular weight of 329.80 g/mol. Its IUPAC name is 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 71508320 |
| Molecular Formula | C15H16ClN7 |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(NCCNc2ccnc3cc(Cl)ccc23)nc(N)n1 |
| InChI | InChI=1S/C15H16ClN7/c16-9-1-2-10-11(3-4-19-12(10)7-9)20-5-6-21-14-8-13(17)22-15(18)23-14/h1-4,7-8H,5-6H2,(H,19,20)(H5,17,18,21,22,23) |
| InChIKey | JOUMMFGRADYBQF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|