C25H21N5O7S — CID 71508409
ethyl 1-(3-nitrophenyl)-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylate (PubChem CID 71508409) has the molecular formula C25H21N5O7S and a molecular weight of 535.54 g/mol. Its IUPAC name is ethyl 1-(3-nitrophenyl)-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(3-nitrophenyl)-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71508409 |
| Molecular Formula | C25H21N5O7S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | ethyl 1-(3-nitrophenyl)-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)Nc2ccc(S(N)(=O)=O)cc2)nn(-c2cccc([N+](=O)[O-])c2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21N5O7S/c1-2-37-25(32)21-22(24(31)27-17-11-13-20(14-12-17)38(26,35)36)28-29(23(21)16-7-4-3-5-8-16)18-9-6-10-19(15-18)30(33)34/h3-15H,2H2,1H3,(H,27,31)(H2,26,35,36) |
| InChIKey | LDQWXAQCCSMWHN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 176.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|