C30H28N6O8S — CID 71508510
1-[3-[(2E)-2-(1-methoxy-4-methyl-1,3-dioxopentan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylic acid (PubChem CID 71508510) has the molecular formula C30H28N6O8S and a molecular weight of 632.66 g/mol. Its IUPAC name is 1-[3-[(2E)-2-(1-methoxy-4-methyl-1,3-dioxopentan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[3-[(2E)-2-(1-methoxy-4-methyl-1,3-dioxopentan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71508510 |
| Molecular Formula | C30H28N6O8S |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 1-[3-[(2E)-2-(1-methoxy-4-methyl-1,3-dioxopentan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-3-[(4-sulfamoylphenyl)carbamoyl]pyrazole-4-carboxylic acid |
| SMILES | COC(=O)/C(=N/Nc1cccc(-n2nc(C(=O)Nc3ccc(S(N)(=O)=O)cc3)c(C(=O)O)c2-c2ccccc2)c1)C(=O)C(C)C |
| InChI | InChI=1S/C30H28N6O8S/c1-17(2)27(37)25(30(41)44-3)34-33-20-10-7-11-21(16-20)36-26(18-8-5-4-6-9-18)23(29(39)40)24(35-36)28(38)32-19-12-14-22(15-13-19)45(31,42)43/h4-17,33H,1-3H3,(H,32,38)(H,39,40)(H2,31,42,43)/b34-25+ |
| InChIKey | WHHQKIWMIJQBPO-YQCHCMBFSA-N |
| XLogP | 3.30 |
| TPSA | 212.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|