About (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine
(2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine (PubChem CID 71508602) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine.
Molecular Properties
| Compound Name | (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine |
| PubChem CID | 71508602 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine |
| SMILES | C#CCN(C)[C@H](CF)CC(=C)C |
| InChI | InChI=1S/C10H16FN/c1-5-6-12(4)10(8-11)7-9(2)3/h1,10H,2,6-8H2,3-4H3/t10-/m0/s1 |
| InChIKey | RGSYIBGBLSBYNE-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine?
The IUPAC name of (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine (CID 71508602) is (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine.
What is the SMILES notation for (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine?
The canonical SMILES for (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine is C#CCN(C)[C@H](CF)CC(=C)C.
What is the InChIKey of (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine?
The InChIKey is RGSYIBGBLSBYNE-JTQLQIEISA-N. The full InChI is InChI=1S/C10H16FN/c1-5-6-12(4)10(8-11)7-9(2)3/h1,10H,2,6-8H2,3-4H3/t10-/m0/s1.
What are the key properties of (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine?
(2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine has a molecular weight of 169.24 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-fluoro-N,4-dimethyl-N-prop-2-ynylpent-4-en-2-amine is sourced from PubChem (CID 71508602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).