C22H21FO3 — CID 71508610
(2E,6E)-2-[(3,5-dimethoxyphenyl)methylidene]-6-[(2-fluorophenyl)methylidene]cyclohexan-1-one (PubChem CID 71508610) has the molecular formula C22H21FO3 and a molecular weight of 352.41 g/mol. Its IUPAC name is (2E,6E)-2-[(3,5-dimethoxyphenyl)methylidene]-6-[(2-fluorophenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(3,5-dimethoxyphenyl)methylidene]-6-[(2-fluorophenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 71508610 |
| Molecular Formula | C22H21FO3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2E,6E)-2-[(3,5-dimethoxyphenyl)methylidene]-6-[(2-fluorophenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3ccccc3F)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H21FO3/c1-25-19-11-15(12-20(14-19)26-2)10-17-7-5-8-18(22(17)24)13-16-6-3-4-9-21(16)23/h3-4,6,9-14H,5,7-8H2,1-2H3/b17-10+,18-13+ |
| InChIKey | CLEKNGMKRNGHMK-YAUBYZHOSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|