About 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole
3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole (PubChem CID 71508686) has the molecular formula C24H24N4
and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole.
Molecular Properties
| Compound Name | 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole |
| PubChem CID | 71508686 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole |
| SMILES | CN1CCC(c2cn(-c3ccncc3)c3ccc(-c4ccncc4)cc23)CC1 |
| InChI | InChI=1S/C24H24N4/c1-27-14-8-19(9-15-27)23-17-28(21-6-12-26-13-7-21)24-3-2-20(16-22(23)24)18-4-10-25-11-5-18/h2-7,10-13,16-17,19H,8-9,14-15H2,1H3 |
| InChIKey | IRZPPSVFNZCDTA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole?
The IUPAC name of 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole (CID 71508686) is 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole.
What is the SMILES notation for 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole?
The canonical SMILES for 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole is CN1CCC(c2cn(-c3ccncc3)c3ccc(-c4ccncc4)cc23)CC1.
What is the InChIKey of 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole?
The InChIKey is IRZPPSVFNZCDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4/c1-27-14-8-19(9-15-27)23-17-28(21-6-12-26-13-7-21)24-3-2-20(16-22(23)24)18-4-10-25-11-5-18/h2-7,10-13,16-17,19H,8-9,14-15H2,1H3.
What are the key properties of 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole?
3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole has a molecular weight of 368.48 g/mol, XLogP of 4.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylpiperidin-4-yl)-1,5-dipyridin-4-ylindole is sourced from PubChem (CID 71508686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).