C22H34O4 — CID 71508783
[(1E,3S,4R,7E,10Z,12R)-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate (PubChem CID 71508783) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1E,3S,4R,7E,10Z,12R)-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate.
| Compound Name | [(1E,3S,4R,7E,10Z,12R)-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71508783 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1E,3S,4R,7E,10Z,12R)-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CC/C(C)=C/C/C=C(/C)[C@H](O)CC/C(COC(C)=O)=C\[C@@H]1O |
| InChI | InChI=1S/C22H34O4/c1-15(2)20-11-9-16(3)7-6-8-17(4)21(24)12-10-19(13-22(20)25)14-26-18(5)23/h7-8,13,20-22,24-25H,1,6,9-12,14H2,2-5H3/b16-7+,17-8-,19-13+/t20-,21-,22+/m1/s1 |
| InChIKey | VPBCNTHVTXZKPP-XNHSMMQNSA-N |
| XLogP | 4.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|