C22H35ClO4 — CID 71508784
[(1E,3S,4R,7E,11R,12R)-11-chloro-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate (PubChem CID 71508784) has the molecular formula C22H35ClO4 and a molecular weight of 398.97 g/mol. Its IUPAC name is [(1E,3S,4R,7E,11R,12R)-11-chloro-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate.
| Compound Name | [(1E,3S,4R,7E,11R,12R)-11-chloro-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71508784 |
| Molecular Formula | C22H35ClO4 |
| Molecular Weight | 398.97 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [(1E,3S,4R,7E,11R,12R)-11-chloro-3,12-dihydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CC/C(C)=C/CC[C@@](C)(Cl)[C@H](O)CC/C(COC(C)=O)=C\[C@@H]1O |
| InChI | InChI=1S/C22H35ClO4/c1-15(2)19-10-8-16(3)7-6-12-22(5,23)21(26)11-9-18(13-20(19)25)14-27-17(4)24/h7,13,19-21,25-26H,1,6,8-12,14H2,2-5H3/b16-7+,18-13+/t19-,20+,21-,22-/m1/s1 |
| InChIKey | CTXOXYCAHHELNX-GCUFCZPASA-N |
| XLogP | 4.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|