C22H34O3 — CID 71508788
[(1E,4S,7E,10Z,12R)-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate (PubChem CID 71508788) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1E,4S,7E,10Z,12R)-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate.
| Compound Name | [(1E,4S,7E,10Z,12R)-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71508788 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1E,4S,7E,10Z,12R)-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1C/C=C(/COC(C)=O)CC[C@@H](O)/C(C)=C\C/C=C(\C)CC1 |
| InChI | InChI=1S/C22H34O3/c1-16(2)21-12-9-17(3)7-6-8-18(4)22(24)14-11-20(10-13-21)15-25-19(5)23/h7-8,10,21-22,24H,1,6,9,11-15H2,2-5H3/b17-7+,18-8-,20-10+/t21-,22+/m0/s1 |
| InChIKey | JOWROYCWHPPODS-BLTQDHEASA-N |
| XLogP | 5.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|