C14H5F5N2O — CID 71508881
(E)-3-(2,3,4,5,6-pentafluorophenyl)-2-(1H-pyrrole-2-carbonyl)prop-2-enenitrile (PubChem CID 71508881) has the molecular formula C14H5F5N2O and a molecular weight of 312.20 g/mol. Its IUPAC name is (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-(1H-pyrrole-2-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-(1H-pyrrole-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 71508881 |
| Molecular Formula | C14H5F5N2O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-(1H-pyrrole-2-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(F)c(F)c(F)c(F)c1F)C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C14H5F5N2O/c15-9-7(10(16)12(18)13(19)11(9)17)4-6(5-20)14(22)8-2-1-3-21-8/h1-4,21H/b6-4+ |
| InChIKey | BLRDZBUKNUZAPW-GQCTYLIASA-N |
| XLogP | 3.50 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|