About 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol
1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol (PubChem CID 71509562) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol |
| PubChem CID | 71509562 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol |
| SMILES | Cc1c2ccnc(CO)c2cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C18H16N2O2/c1-10-12-5-6-19-16(9-21)13(12)8-15-14-7-11(22)3-4-17(14)20(2)18(10)15/h3-8,21-22H,9H2,1-2H3 |
| InChIKey | CLRNDLVDVPMNGS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol?
The IUPAC name of 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol (CID 71509562) is 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol.
What is the SMILES notation for 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol?
The canonical SMILES for 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol is Cc1c2ccnc(CO)c2cc2c3cc(O)ccc3n(C)c12.
What is the InChIKey of 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol?
The InChIKey is CLRNDLVDVPMNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-10-12-5-6-19-16(9-21)13(12)8-15-14-7-11(22)3-4-17(14)20(2)18(10)15/h3-8,21-22H,9H2,1-2H3.
What are the key properties of 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol?
1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol has a molecular weight of 292.34 g/mol, XLogP of 3.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-5,6-dimethylpyrido[4,3-b]carbazol-9-ol is sourced from PubChem (CID 71509562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).