C18H18N2O2S — CID 71509638
(5Z)-1-ethyl-5-[(E)-3-phenylprop-2-enylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 71509638) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is (5Z)-1-ethyl-5-[(E)-3-phenylprop-2-enylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-1-ethyl-5-[(E)-3-phenylprop-2-enylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 71509638 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (5Z)-1-ethyl-5-[(E)-3-phenylprop-2-enylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)/C(=C\C=C\c2ccccc2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C18H18N2O2S/c1-3-13-20-17(22)15(16(21)19(4-2)18(20)23)12-8-11-14-9-6-5-7-10-14/h3,5-12H,1,4,13H2,2H3/b11-8+,15-12- |
| InChIKey | PMQLUSSZBZTELM-QUHNVXOFSA-N |
| XLogP | 2.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|