About 4-prop-2-enoyl-1,4-oxazepan-7-one
4-prop-2-enoyl-1,4-oxazepan-7-one (PubChem CID 71509761) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-prop-2-enoyl-1,4-oxazepan-7-one.
Molecular Properties
| Compound Name | 4-prop-2-enoyl-1,4-oxazepan-7-one |
| PubChem CID | 71509761 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-prop-2-enoyl-1,4-oxazepan-7-one |
| SMILES | C=CC(=O)N1CCOC(=O)CC1 |
| InChI | InChI=1S/C8H11NO3/c1-2-7(10)9-4-3-8(11)12-6-5-9/h2H,1,3-6H2 |
| InChIKey | HZSYCRQGBIGVJS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoyl-1,4-oxazepan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoyl-1,4-oxazepan-7-one?
The IUPAC name of 4-prop-2-enoyl-1,4-oxazepan-7-one (CID 71509761) is 4-prop-2-enoyl-1,4-oxazepan-7-one.
What is the SMILES notation for 4-prop-2-enoyl-1,4-oxazepan-7-one?
The canonical SMILES for 4-prop-2-enoyl-1,4-oxazepan-7-one is C=CC(=O)N1CCOC(=O)CC1.
What is the InChIKey of 4-prop-2-enoyl-1,4-oxazepan-7-one?
The InChIKey is HZSYCRQGBIGVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-2-7(10)9-4-3-8(11)12-6-5-9/h2H,1,3-6H2.
What are the key properties of 4-prop-2-enoyl-1,4-oxazepan-7-one?
4-prop-2-enoyl-1,4-oxazepan-7-one has a molecular weight of 169.18 g/mol, XLogP of -0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoyl-1,4-oxazepan-7-one is sourced from PubChem (CID 71509761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).