C26H24ClF2NO6S2 — CID 71509860
3-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyridine (PubChem CID 71509860) has the molecular formula C26H24ClF2NO6S2 and a molecular weight of 584.06 g/mol. Its IUPAC name is 3-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyridine.
| Compound Name | 3-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyridine |
|---|---|
| PubChem CID | 71509860 |
| Molecular Formula | C26H24ClF2NO6S2 |
| Molecular Weight | 584.06 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 3-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyridine |
| SMILES | O=S(=O)(CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12)Cc1cccnc1 |
| InChI | InChI=1S/C26H24ClF2NO6S2/c27-18-3-5-19(6-4-18)38(33,34)26-10-12-35-23(9-13-37(31,32)16-17-2-1-11-30-14-17)20(26)15-36-25-22(29)8-7-21(28)24(25)26/h1-8,11,14,20,23H,9-10,12-13,15-16H2/t20-,23-,26-/m0/s1 |
| InChIKey | TWICHZABMFYFLE-CHZKFRDHSA-N |
| XLogP | 4.49 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |