C24H31NO7S — CID 71510419
4-[3-(3,5-dimethylpiperidin-1-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxopropyl]benzenesulfonic acid (PubChem CID 71510419) has the molecular formula C24H31NO7S and a molecular weight of 477.58 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpiperidin-1-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxopropyl]benzenesulfonic acid.
| Compound Name | 4-[3-(3,5-dimethylpiperidin-1-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxopropyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71510419 |
| Molecular Formula | C24H31NO7S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 4-[3-(3,5-dimethylpiperidin-1-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxopropyl]benzenesulfonic acid |
| SMILES | COc1cc(O)c(C(CC(=O)N2CC(C)CC(C)C2)c2ccc(S(=O)(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H31NO7S/c1-15-9-16(2)14-25(13-15)23(27)12-20(17-5-7-19(8-6-17)33(28,29)30)24-21(26)10-18(31-3)11-22(24)32-4/h5-8,10-11,15-16,20,26H,9,12-14H2,1-4H3,(H,28,29,30) |
| InChIKey | KWBTWWOTZFJDSQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|