C27H43NO3 — CID 71510532
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-methoxyethoxy)ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 71510532) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-methoxyethoxy)ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-methoxyethoxy)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 71510532 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-methoxyethoxy)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOCCOC |
| InChI | InChI=1S/C27H43NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(29)28-23-24-31-26-25-30-2/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-26H2,1-2H3,(H,28,29)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | HZVWDFOOVLLBRW-JDPCYWKWSA-N |
| XLogP | 6.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|