C29H47NO4 — CID 71510663
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 71510663) has the molecular formula C29H47NO4 and a molecular weight of 473.70 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 71510663 |
| Molecular Formula | C29H47NO4 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOCCOCCOC |
| InChI | InChI=1S/C29H47NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(31)30-23-24-33-27-28-34-26-25-32-2/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-28H2,1-2H3,(H,30,31)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | ZVOCMAUJPHQGSO-JDPCYWKWSA-N |
| XLogP | 6.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|