C41H65NO11S2 — CID 71511281
[8-[2-[4-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 71511281) has the molecular formula C41H65NO11S2 and a molecular weight of 812.10 g/mol. Its IUPAC name is [8-[2-[4-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[2-[4-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 71511281 |
| Molecular Formula | C41H65NO11S2 |
| Molecular Weight | 812.10 g/mol |
| Exact Mass | 811.40 |
| IUPAC Name | [8-[2-[4-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(=O)OCCOCCOCCOCCNC(=O)CCCCC4CCSS4)CC(=O)O3)C21 |
| InChI | InChI=1S/C41H65NO11S2/c1-5-29(3)40(45)53-36-25-28(2)24-31-11-10-30(4)35(39(31)36)13-12-32-26-33(27-38(44)51-32)52-41(46)50-22-21-49-20-19-48-18-17-47-16-15-42-37(43)9-7-6-8-34-14-23-54-55-34/h10-11,24,28-30,32-36,39H,5-9,12-23,25-27H2,1-4H3,(H,42,43) |
| InChIKey | MYIRPRKJGWMEFS-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.10 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|