C37H57NO9S2 — CID 71511282
[8-[2-[4-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 71511282) has the molecular formula C37H57NO9S2 and a molecular weight of 723.99 g/mol. Its IUPAC name is [8-[2-[4-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[2-[4-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 71511282 |
| Molecular Formula | C37H57NO9S2 |
| Molecular Weight | 723.99 g/mol |
| Exact Mass | 723.35 |
| IUPAC Name | [8-[2-[4-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(=O)OCCOCCNC(=O)CCCCC4CCSS4)CC(=O)O3)C21 |
| InChI | InChI=1S/C37H57NO9S2/c1-5-25(3)36(41)47-32-21-24(2)20-27-11-10-26(4)31(35(27)32)13-12-28-22-29(23-34(40)45-28)46-37(42)44-18-17-43-16-15-38-33(39)9-7-6-8-30-14-19-48-49-30/h10-11,20,24-26,28-32,35H,5-9,12-19,21-23H2,1-4H3,(H,38,39) |
| InChIKey | KYQJEGGUYFERBI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.99 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|