C39H61NO8S2 — CID 71511312
[8-[2-[4-[6-[5-(dithiolan-3-yl)pentanoylamino]hexoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 71511312) has the molecular formula C39H61NO8S2 and a molecular weight of 736.05 g/mol. Its IUPAC name is [8-[2-[4-[6-[5-(dithiolan-3-yl)pentanoylamino]hexoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[2-[4-[6-[5-(dithiolan-3-yl)pentanoylamino]hexoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 71511312 |
| Molecular Formula | C39H61NO8S2 |
| Molecular Weight | 736.05 g/mol |
| Exact Mass | 735.38 |
| IUPAC Name | [8-[2-[4-[6-[5-(dithiolan-3-yl)pentanoylamino]hexoxycarbonyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(=O)OCCCCCCNC(=O)CCCCC4CCSS4)CC(=O)O3)C21 |
| InChI | InChI=1S/C39H61NO8S2/c1-5-27(3)38(43)48-34-23-26(2)22-29-15-14-28(4)33(37(29)34)17-16-30-24-31(25-36(42)46-30)47-39(44)45-20-11-7-6-10-19-40-35(41)13-9-8-12-32-18-21-49-50-32/h14-15,22,26-28,30-34,37H,5-13,16-21,23-25H2,1-4H3,(H,40,41) |
| InChIKey | TXPRMUVPQNOBNW-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.05 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|