C21H23ClN8O — CID 71511622
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 71511622) has the molecular formula C21H23ClN8O and a molecular weight of 438.92 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 71511622 |
| Molecular Formula | C21H23ClN8O |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCNc3nc(N)nc(N)n3)c2c1 |
| InChI | InChI=1S/C21H23ClN8O/c1-31-13-5-7-16-15(11-13)18(14-6-4-12(22)10-17(14)27-16)25-8-2-3-9-26-21-29-19(23)28-20(24)30-21/h4-7,10-11H,2-3,8-9H2,1H3,(H,25,27)(H5,23,24,26,28,29,30) |
| InChIKey | YRQBNFDRSZQBNL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|