C18H19N3O4S — CID 71511992
(2R,3R,4S,5S)-2-[4-(6-methoxynaphthalen-2-yl)triazol-1-yl]thiane-3,4,5-triol (PubChem CID 71511992) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-(6-methoxynaphthalen-2-yl)triazol-1-yl]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[4-(6-methoxynaphthalen-2-yl)triazol-1-yl]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 71511992 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-(6-methoxynaphthalen-2-yl)triazol-1-yl]thiane-3,4,5-triol |
| SMILES | COc1ccc2cc(-c3cn([C@@H]4SC[C@@H](O)[C@H](O)[C@H]4O)nn3)ccc2c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-25-13-5-4-10-6-12(3-2-11(10)7-13)14-8-21(20-19-14)18-17(24)16(23)15(22)9-26-18/h2-8,15-18,22-24H,9H2,1H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | GPCZKVFGPGHXFV-XMTFNYHQSA-N |
| XLogP | 1.43 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |