About N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide
N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 71512316) has the molecular formula C14H17F4N5
and a molecular weight of 331.32 g/mol. Its IUPAC name is N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| PubChem CID | 71512316 |
| Molecular Formula | C14H17F4N5 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N/C(N)=N/c1ccc(F)c(C(F)(F)F)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H17F4N5/c15-11-5-4-9(8-10(11)14(16,17)18)21-12(19)22-13(20)23-6-2-1-3-7-23/h4-5,8H,1-3,6-7H2,(H4,19,20,21,22) |
| InChIKey | SOARXXJOEYYCCX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The IUPAC name of N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide (CID 71512316) is N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
What is the SMILES notation for N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The canonical SMILES for N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide is N/C(=N/C(N)=N/c1ccc(F)c(C(F)(F)F)c1)N1CCCCC1.
What is the InChIKey of N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The InChIKey is SOARXXJOEYYCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F4N5/c15-11-5-4-9(8-10(11)14(16,17)18)21-12(19)22-13(20)23-6-2-1-3-7-23/h4-5,8H,1-3,6-7H2,(H4,19,20,21,22).
What are the key properties of N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide has a molecular weight of 331.32 g/mol, XLogP of 2.59, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide is sourced from PubChem (CID 71512316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).