C20H17N3O3S — CID 7151232
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2,3-dimethoxybenzamide (PubChem CID 7151232) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 7151232 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(-c3cn4ccsc4n3)c2)c1OC |
| InChI | InChI=1S/C20H17N3O3S/c1-25-17-8-4-7-15(18(17)26-2)19(24)21-14-6-3-5-13(11-14)16-12-23-9-10-27-20(23)22-16/h3-12H,1-2H3,(H,21,24) |
| InChIKey | PQRDVEWLGOBAAS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |