C20H28O — CID 71512321
(4R,5E,7S)-10-benzyl-5,7-dimethylundeca-1,5,10-trien-4-ol (PubChem CID 71512321) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (4R,5E,7S)-10-benzyl-5,7-dimethylundeca-1,5,10-trien-4-ol.
| Compound Name | (4R,5E,7S)-10-benzyl-5,7-dimethylundeca-1,5,10-trien-4-ol |
|---|---|
| PubChem CID | 71512321 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (4R,5E,7S)-10-benzyl-5,7-dimethylundeca-1,5,10-trien-4-ol |
| SMILES | C=CC[C@@H](O)/C(C)=C/[C@@H](C)CCC(=C)Cc1ccccc1 |
| InChI | InChI=1S/C20H28O/c1-5-9-20(21)18(4)14-16(2)12-13-17(3)15-19-10-7-6-8-11-19/h5-8,10-11,14,16,20-21H,1,3,9,12-13,15H2,2,4H3/b18-14+/t16-,20+/m0/s1 |
| InChIKey | CZLPMTFBHMLOHX-WKMQTEFXSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|