About [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate
[1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate (PubChem CID 71512668) has the molecular formula C14H18FNO3S
and a molecular weight of 299.37 g/mol. Its IUPAC name is [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate.
Molecular Properties
| Compound Name | [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate |
| PubChem CID | 71512668 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate |
| SMILES | CC(C)(C)CC(OS(C)(=O)=O)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C14H18FNO3S/c1-14(2,3)8-13(19-20(4,17)18)10-5-6-11(9-16)12(15)7-10/h5-7,13H,8H2,1-4H3 |
| InChIKey | UZUQFKQWWQMAGO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate?
The IUPAC name of [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate (CID 71512668) is [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate.
What is the SMILES notation for [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate?
The canonical SMILES for [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate is CC(C)(C)CC(OS(C)(=O)=O)c1ccc(C#N)c(F)c1.
What is the InChIKey of [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate?
The InChIKey is UZUQFKQWWQMAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO3S/c1-14(2,3)8-13(19-20(4,17)18)10-5-6-11(9-16)12(15)7-10/h5-7,13H,8H2,1-4H3.
What are the key properties of [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate?
[1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate has a molecular weight of 299.37 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyano-3-fluorophenyl)-3,3-dimethylbutyl] methanesulfonate is sourced from PubChem (CID 71512668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).