C17H19N3OS — CID 7151267
N-[3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]pentanamide (PubChem CID 7151267) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]pentanamide.
| Compound Name | N-[3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 7151267 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(-c2cn3c(C)csc3n2)c1 |
| InChI | InChI=1S/C17H19N3OS/c1-3-4-8-16(21)18-14-7-5-6-13(9-14)15-10-20-12(2)11-22-17(20)19-15/h5-7,9-11H,3-4,8H2,1-2H3,(H,18,21) |
| InChIKey | OLXQGRARORLKQY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |