C9H9NO2S — CID 71513744
6-methoxy-2-methyl-1,2-benzothiazol-3-one (PubChem CID 71513744) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 6-methoxy-2-methyl-1,2-benzothiazol-3-one.
| Compound Name | 6-methoxy-2-methyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 71513744 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 6-methoxy-2-methyl-1,2-benzothiazol-3-one |
| SMILES | COc1ccc2c(=O)n(C)sc2c1 |
| InChI | InChI=1S/C9H9NO2S/c1-10-9(11)7-4-3-6(12-2)5-8(7)13-10/h3-5H,1-2H3 |
| InChIKey | BIMCUMDIXRMMLN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |