C17H16N2O2 — CID 71514247
3-ethyl-5-(5-phenylmethoxy-3-pyridinyl)-1,2-oxazole (PubChem CID 71514247) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-ethyl-5-(5-phenylmethoxy-3-pyridinyl)-1,2-oxazole.
| Compound Name | 3-ethyl-5-(5-phenylmethoxy-3-pyridinyl)-1,2-oxazole |
|---|---|
| PubChem CID | 71514247 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-ethyl-5-(5-phenylmethoxy-3-pyridinyl)-1,2-oxazole |
| SMILES | CCc1cc(-c2cncc(OCc3ccccc3)c2)on1 |
| InChI | InChI=1S/C17H16N2O2/c1-2-15-9-17(21-19-15)14-8-16(11-18-10-14)20-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| InChIKey | DTTJWHYACOGKGQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |