C42H50N2O6Si — CID 71514390
(4S,5R,6S,7S,8S,9R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-4,9-dimethyl-7-(3-prop-1-en-2-ylanilino)-3-oxa-1-azaspiro[4.4]non-1-ene-6,8,9-triol (PubChem CID 71514390) has the molecular formula C42H50N2O6Si and a molecular weight of 706.96 g/mol. Its IUPAC name is (4S,5R,6S,7S,8S,9R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-4,9-dimethyl-7-(3-prop-1-en-2-ylanilino)-3-oxa-1-azaspiro[4.4]non-1-ene-6,8,9-triol.
| Compound Name | (4S,5R,6S,7S,8S,9R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-4,9-dimethyl-7-(3-prop-1-en-2-ylanilino)-3-oxa-1-azaspiro[4.4]non-1-ene-6,8,9-triol |
|---|---|
| PubChem CID | 71514390 |
| Molecular Formula | C42H50N2O6Si |
| Molecular Weight | 706.96 g/mol |
| Exact Mass | 706.34 |
| IUPAC Name | (4S,5R,6S,7S,8S,9R)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-4,9-dimethyl-7-(3-prop-1-en-2-ylanilino)-3-oxa-1-azaspiro[4.4]non-1-ene-6,8,9-triol |
| SMILES | C=C(C)c1cccc(N[C@H]2[C@H](O)[C@]3(N=C(c4ccc(OC)cc4)O[C@H]3C)[C@@](C)(O)[C@@]2(O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C42H50N2O6Si/c1-28(2)31-16-15-17-32(26-31)43-36-37(45)42(29(3)50-38(44-42)30-22-24-33(48-8)25-23-30)40(7,46)41(36,47)27-49-51(39(4,5)6,34-18-11-9-12-19-34)35-20-13-10-14-21-35/h9-26,29,36-37,43,45-47H,1,27H2,2-8H3/t29-,36-,37-,40-,41+,42-/m0/s1 |
| InChIKey | FJJWAZSKICIXBJ-JIQHPXABSA-N |
| XLogP | 5.55 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|