C18H21NO7 — CID 71514392
[(1'R,2'S,4S,4'R,5S,5'S)-4'-hydroxy-5'-(hydroxymethyl)-2-(4-methoxyphenyl)-5-methylspiro[5H-1,3-oxazole-4,3'-6-oxabicyclo[3.1.0]hexane]-2'-yl] acetate (PubChem CID 71514392) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is [(1'R,2'S,4S,4'R,5S,5'S)-4'-hydroxy-5'-(hydroxymethyl)-2-(4-methoxyphenyl)-5-methylspiro[5H-1,3-oxazole-4,3'-6-oxabicyclo[3.1.0]hexane]-2'-yl] acetate.
| Compound Name | [(1'R,2'S,4S,4'R,5S,5'S)-4'-hydroxy-5'-(hydroxymethyl)-2-(4-methoxyphenyl)-5-methylspiro[5H-1,3-oxazole-4,3'-6-oxabicyclo[3.1.0]hexane]-2'-yl] acetate |
|---|---|
| PubChem CID | 71514392 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [(1'R,2'S,4S,4'R,5S,5'S)-4'-hydroxy-5'-(hydroxymethyl)-2-(4-methoxyphenyl)-5-methylspiro[5H-1,3-oxazole-4,3'-6-oxabicyclo[3.1.0]hexane]-2'-yl] acetate |
| SMILES | COc1ccc(C2=N[C@@]3([C@H](C)O2)[C@H](OC(C)=O)[C@H]2O[C@@]2(CO)[C@@H]3O)cc1 |
| InChI | InChI=1S/C18H21NO7/c1-9-18(19-15(24-9)11-4-6-12(23-3)7-5-11)14(25-10(2)21)13-17(8-20,26-13)16(18)22/h4-7,9,13-14,16,20,22H,8H2,1-3H3/t9-,13+,14+,16-,17+,18-/m0/s1 |
| InChIKey | HKJIRDUIPRKKFR-MJKGFFQOSA-N |
| XLogP | 0.04 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|