C22H22ClN3O3 — CID 71514534
6-[(E)-3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 71514534) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 6-[(E)-3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 71514534 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 6-[(E)-3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CCC(O)(c4ccc(Cl)cc4)CC3)cnc2N1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-18-5-3-17(4-6-18)22(29)9-11-26(12-10-22)20(28)8-1-15-13-16-2-7-19(27)25-21(16)24-14-15/h1,3-6,8,13-14,29H,2,7,9-12H2,(H,24,25,27)/b8-1+ |
| InChIKey | NHRLHKWVEYHJDN-UNXLUWIOSA-N |
| XLogP | 3.14 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|