About N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide
N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide (PubChem CID 71514800) has the molecular formula C12H25N5
and a molecular weight of 239.37 g/mol. Its IUPAC name is N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide |
| PubChem CID | 71514800 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide |
| SMILES | CCCCCC/N=C(/N=C(N)N)N1CCCC1 |
| InChI | InChI=1S/C12H25N5/c1-2-3-4-5-8-15-12(16-11(13)14)17-9-6-7-10-17/h2-10H2,1H3,(H4,13,14,15,16) |
| InChIKey | CKAQHMXZUWOUQJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide?
The IUPAC name of N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide (CID 71514800) is N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide.
What is the SMILES notation for N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide?
The canonical SMILES for N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide is CCCCCC/N=C(/N=C(N)N)N1CCCC1.
What is the InChIKey of N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide?
The InChIKey is CKAQHMXZUWOUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N5/c1-2-3-4-5-8-15-12(16-11(13)14)17-9-6-7-10-17/h2-10H2,1H3,(H4,13,14,15,16).
What are the key properties of N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide?
N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide has a molecular weight of 239.37 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-N'-hexylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 71514800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).