C40H56N2O6 — CID 71515904
1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one (PubChem CID 71515904) has the molecular formula C40H56N2O6 and a molecular weight of 660.90 g/mol. Its IUPAC name is 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one.
| Compound Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one |
|---|---|
| PubChem CID | 71515904 |
| Molecular Formula | C40H56N2O6 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one |
| SMILES | COc1c(OCCCCN2CCCC2)cc2oc3cc(OCCCCN4CCCC4)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C40H56N2O6/c1-28(2)14-16-30-32(46-24-12-10-22-41-18-6-7-19-41)26-34-37(38(30)43)39(44)36-31(17-15-29(3)4)40(45-5)35(27-33(36)48-34)47-25-13-11-23-42-20-8-9-21-42/h14-15,26-27,43H,6-13,16-25H2,1-5H3 |
| InChIKey | GAZXCEALXSQVJS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|