C30H34O8 — CID 71515968
1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one (PubChem CID 71515968) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one.
| Compound Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one |
|---|---|
| PubChem CID | 71515968 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(oxiran-2-ylmethoxy)xanthen-9-one |
| SMILES | COc1c(OCC2CO2)cc2oc3cc(OCC4CO4)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C30H34O8/c1-16(2)6-8-20-22(36-14-18-12-34-18)10-24-27(28(20)31)29(32)26-21(9-7-17(3)4)30(33-5)25(11-23(26)38-24)37-15-19-13-35-19/h6-7,10-11,18-19,31H,8-9,12-15H2,1-5H3 |
| InChIKey | JRTKJBBVWOHUNM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|