C11H14ClNO — CID 71516194
3-[(R)-(4-chlorophenyl)-methoxymethyl]azetidine (PubChem CID 71516194) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 3-[(R)-(4-chlorophenyl)-methoxymethyl]azetidine.
| Compound Name | 3-[(R)-(4-chlorophenyl)-methoxymethyl]azetidine |
|---|---|
| PubChem CID | 71516194 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-[(R)-(4-chlorophenyl)-methoxymethyl]azetidine |
| SMILES | CO[C@@H](c1ccc(Cl)cc1)C1CNC1 |
| InChI | InChI=1S/C11H14ClNO/c1-14-11(9-6-13-7-9)8-2-4-10(12)5-3-8/h2-5,9,11,13H,6-7H2,1H3/t11-/m0/s1 |
| InChIKey | ATIFLIBBENKCKM-NSHDSACASA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |