About 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine
8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine (PubChem CID 71516494) has the molecular formula C12H8Cl3N5
and a molecular weight of 328.59 g/mol. Its IUPAC name is 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine |
| PubChem CID | 71516494 |
| Molecular Formula | C12H8Cl3N5 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine |
| SMILES | Clc1nc2ncnc(NCc3cccc(Cl)c3Cl)c2[nH]1 |
| InChI | InChI=1S/C12H8Cl3N5/c13-7-3-1-2-6(8(7)14)4-16-10-9-11(18-5-17-10)20-12(15)19-9/h1-3,5H,4H2,(H2,16,17,18,19,20) |
| InChIKey | IFSHWQLHABPFIL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine?
The IUPAC name of 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine (CID 71516494) is 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine.
What is the SMILES notation for 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine?
The canonical SMILES for 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine is Clc1nc2ncnc(NCc3cccc(Cl)c3Cl)c2[nH]1.
What is the InChIKey of 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine?
The InChIKey is IFSHWQLHABPFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl3N5/c13-7-3-1-2-6(8(7)14)4-16-10-9-11(18-5-17-10)20-12(15)19-9/h1-3,5H,4H2,(H2,16,17,18,19,20).
What are the key properties of 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine?
8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine has a molecular weight of 328.59 g/mol, XLogP of 3.93, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-[(2,3-dichlorophenyl)methyl]-7H-purin-6-amine is sourced from PubChem (CID 71516494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).