C29H27N7 — CID 71516900
6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-3-yl]phenyl]imidazo[1,2-a]pyridine (PubChem CID 71516900) has the molecular formula C29H27N7 and a molecular weight of 473.58 g/mol. Its IUPAC name is 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-3-yl]phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-3-yl]phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71516900 |
| Molecular Formula | C29H27N7 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-3-yl]phenyl]imidazo[1,2-a]pyridine |
| SMILES | c1cc2c(-c3ccc(-c4cn5cc(C6=NCCCN6)ccc5n4)cc3)c[nH]c2cc1C1=NCCCN1 |
| InChI | InChI=1S/C29H27N7/c1-11-30-28(31-12-1)21-7-9-23-24(16-34-25(23)15-21)19-3-5-20(6-4-19)26-18-36-17-22(8-10-27(36)35-26)29-32-13-2-14-33-29/h3-10,15-18,34H,1-2,11-14H2,(H,30,31)(H,32,33) |
| InChIKey | DXYIGSSRKFIZNF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |