C28H25N5OS — CID 71516929
6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole (PubChem CID 71516929) has the molecular formula C28H25N5OS and a molecular weight of 479.61 g/mol. Its IUPAC name is 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole.
| Compound Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 71516929 |
| Molecular Formula | C28H25N5OS |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole |
| SMILES | c1cc2c(-c3ccc(-c4cc5ccc(C6=NCCCN6)cc5o4)s3)c[nH]c2cc1C1=NCCCN1 |
| InChI | InChI=1S/C28H25N5OS/c1-9-29-27(30-10-1)18-5-6-20-21(16-33-22(20)13-18)25-7-8-26(35-25)24-14-17-3-4-19(15-23(17)34-24)28-31-11-2-12-32-28/h3-8,13-16,33H,1-2,9-12H2,(H,29,30)(H,31,32) |
| InChIKey | YRLKWTZCBJOJAF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |