C14H28O6Si — CID 71517005
(2R,3R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-oxooctanoic acid (PubChem CID 71517005) has the molecular formula C14H28O6Si and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R,3R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-oxooctanoic acid.
| Compound Name | (2R,3R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-oxooctanoic acid |
|---|---|
| PubChem CID | 71517005 |
| Molecular Formula | C14H28O6Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2R,3R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-oxooctanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(=O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H28O6Si/c1-14(2,3)21(4,5)20-9-7-6-8-10(15)11(16)12(17)13(18)19/h11-12,16-17H,6-9H2,1-5H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | KWHZIUGYBJOBBF-NWDGAFQWSA-N |
| XLogP | 1.55 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|