About (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate
(2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate (PubChem CID 71517027) has the molecular formula C22H21ClO3
and a molecular weight of 368.86 g/mol. Its IUPAC name is (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate.
Molecular Properties
| Compound Name | (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate |
| PubChem CID | 71517027 |
| Molecular Formula | C22H21ClO3 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate |
| SMILES | CC1(C)CC(=O)C(Cl)=C(OC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H21ClO3/c1-22(2)13-17(24)20(23)18(14-22)26-21(25)19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,19H,13-14H2,1-2H3 |
| InChIKey | CIEIYZQIKOJGGD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate?
The IUPAC name of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate (CID 71517027) is (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate.
What is the SMILES notation for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate?
The canonical SMILES for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate is CC1(C)CC(=O)C(Cl)=C(OC(=O)C(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate?
The InChIKey is CIEIYZQIKOJGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClO3/c1-22(2)13-17(24)20(23)18(14-22)26-21(25)19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,19H,13-14H2,1-2H3.
What are the key properties of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate?
(2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate has a molecular weight of 368.86 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) 2,2-diphenylacetate is sourced from PubChem (CID 71517027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).