About S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate
S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate (PubChem CID 71517149) has the molecular formula C21H40O3S
and a molecular weight of 372.62 g/mol. Its IUPAC name is S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate.
Molecular Properties
| Compound Name | S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate |
| PubChem CID | 71517149 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)SCC(O)CO |
| InChI | InChI=1S/C21H40O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | IZALKARMTKRPLC-KTKRTIGZSA-N |
| XLogP | 5.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate?
The IUPAC name of S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate (CID 71517149) is S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate.
What is the SMILES notation for S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate?
The canonical SMILES for S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate is CCCCCCCC/C=C\CCCCCCCC(=O)SCC(O)CO.
What is the InChIKey of S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate?
The InChIKey is IZALKARMTKRPLC-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H40O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-.
What are the key properties of S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate?
S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate has a molecular weight of 372.62 g/mol, XLogP of 5.64, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2,3-dihydroxypropyl) (Z)-octadec-9-enethioate is sourced from PubChem (CID 71517149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).