C22H25N3O2 — CID 71517202
N-(4-tert-butylphenyl)-6-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 71517202) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-6-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-6-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 71517202 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-6-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CCc3c([nH]c4ccc(O)cc34)C2)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-22(2,3)14-4-6-15(7-5-14)23-21(27)25-11-10-17-18-12-16(26)8-9-19(18)24-20(17)13-25/h4-9,12,24,26H,10-11,13H2,1-3H3,(H,23,27) |
| InChIKey | HFOVEBXKPMCLNH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|