About 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine
4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine (PubChem CID 71517559) has the molecular formula C17H23ClN2O
and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine |
| PubChem CID | 71517559 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCCOc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H23ClN2O/c1-3-20(4-2)12-5-6-13-21-16-10-9-15(18)14-8-7-11-19-17(14)16/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | UUVQNFRVRUEVPX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine?
The IUPAC name of 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine (CID 71517559) is 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine.
What is the SMILES notation for 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine?
The canonical SMILES for 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine is CCN(CC)CCCCOc1ccc(Cl)c2cccnc12.
What is the InChIKey of 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine?
The InChIKey is UUVQNFRVRUEVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2O/c1-3-20(4-2)12-5-6-13-21-16-10-9-15(18)14-8-7-11-19-17(14)16/h7-11H,3-6,12-13H2,1-2H3.
What are the key properties of 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine?
4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine has a molecular weight of 306.84 g/mol, XLogP of 4.39, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloroquinolin-8-yl)oxy-N,N-diethylbutan-1-amine is sourced from PubChem (CID 71517559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).