C26H33NO2 — CID 71517676
(E)-3-[4-[propyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid (PubChem CID 71517676) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (E)-3-[4-[propyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[propyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71517676 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (E)-3-[4-[propyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid |
| SMILES | CCCN(c1ccc(/C=C/C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H33NO2/c1-6-17-27(20-10-7-19(8-11-20)9-14-24(28)29)21-12-13-22-23(18-21)26(4,5)16-15-25(22,2)3/h7-14,18H,6,15-17H2,1-5H3,(H,28,29)/b14-9+ |
| InChIKey | PPIWEYYTUBYMPB-NTEUORMPSA-N |
| XLogP | 6.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|