C27H35NO2 — CID 71517678
(E)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]prop-2-enoic acid (PubChem CID 71517678) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (E)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71517678 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (E)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]prop-2-enoic acid |
| SMILES | CCCN(c1ccc(/C=C/C(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H35NO2/c1-7-16-28(21-11-8-20(9-12-21)10-13-25(29)30)24-18-23-22(17-19(24)2)26(3,4)14-15-27(23,5)6/h8-13,17-18H,7,14-16H2,1-6H3,(H,29,30)/b13-10+ |
| InChIKey | WHINIFOWJVQEAO-JLHYYAGUSA-N |
| XLogP | 6.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|