C25H20N8O3 — CID 71517704
1-(4-benzoylpiperazin-1-yl)-2-[7-(triazolo[4,5-b]pyridin-3-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 71517704) has the molecular formula C25H20N8O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[7-(triazolo[4,5-b]pyridin-3-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[7-(triazolo[4,5-b]pyridin-3-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 71517704 |
| Molecular Formula | C25H20N8O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[7-(triazolo[4,5-b]pyridin-3-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-n3nnc4cccnc43)ccnc12 |
| InChI | InChI=1S/C25H20N8O3/c34-22(25(36)32-13-11-31(12-14-32)24(35)16-5-2-1-3-6-16)17-15-28-21-19(8-10-26-20(17)21)33-23-18(29-30-33)7-4-9-27-23/h1-10,15,28H,11-14H2 |
| InChIKey | OZBLWESPOLZFNE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|